C10H18BrNO — CID 109398174
2-[[2-bromoprop-2-enyl(methyl)amino]methyl]cyclopentan-1-ol (PubChem CID 109398174) has the molecular formula C10H18BrNO and a molecular weight of 248.16 g/mol. Its IUPAC name is 2-[[2-bromoprop-2-enyl(methyl)amino]methyl]cyclopentan-1-ol.
| Compound Name | 2-[[2-bromoprop-2-enyl(methyl)amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 109398174 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-[[2-bromoprop-2-enyl(methyl)amino]methyl]cyclopentan-1-ol |
| SMILES | C=C(Br)CN(C)CC1CCCC1O |
| InChI | InChI=1S/C10H18BrNO/c1-8(11)6-12(2)7-9-4-3-5-10(9)13/h9-10,13H,1,3-7H2,2H3 |
| InChIKey | WWYVBYQUUWXLIR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |