C34H33NO2 — CID 10939868
tert-butyl (E,2S,3R)-2-(benzhydrylideneamino)-3,5-diphenylpent-4-enoate (PubChem CID 10939868) has the molecular formula C34H33NO2 and a molecular weight of 487.64 g/mol. Its IUPAC name is tert-butyl (E,2S,3R)-2-(benzhydrylideneamino)-3,5-diphenylpent-4-enoate.
| Compound Name | tert-butyl (E,2S,3R)-2-(benzhydrylideneamino)-3,5-diphenylpent-4-enoate |
|---|---|
| PubChem CID | 10939868 |
| Molecular Formula | C34H33NO2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl (E,2S,3R)-2-(benzhydrylideneamino)-3,5-diphenylpent-4-enoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@H](/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H33NO2/c1-34(2,3)37-33(36)32(35-31(28-20-12-6-13-21-28)29-22-14-7-15-23-29)30(27-18-10-5-11-19-27)25-24-26-16-8-4-9-17-26/h4-25,30,32H,1-3H3/b25-24+/t30-,32+/m1/s1 |
| InChIKey | ZZHHZZBYEDLQMF-LXKAUJIESA-N |
| XLogP | 7.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|