C17H22FNO2 — CID 109400129
(Z)-3-(3-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylbut-2-enamide (PubChem CID 109400129) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is (Z)-3-(3-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylbut-2-enamide.
| Compound Name | (Z)-3-(3-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 109400129 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (Z)-3-(3-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylbut-2-enamide |
| SMILES | C/C(=C/C(=O)N(C)CC1CCCC1O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H22FNO2/c1-12(13-5-3-7-15(18)10-13)9-17(21)19(2)11-14-6-4-8-16(14)20/h3,5,7,9-10,14,16,20H,4,6,8,11H2,1-2H3/b12-9- |
| InChIKey | MENGFUDKOVXGEC-XFXZXTDPSA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|