C25H48N4O6 — CID 10940041
tritert-butyl 1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate (PubChem CID 10940041) has the molecular formula C25H48N4O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is tritert-butyl 1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate.
| Compound Name | tritert-butyl 1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
|---|---|
| PubChem CID | 10940041 |
| Molecular Formula | C25H48N4O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.36 |
| IUPAC Name | tritert-butyl 1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCCNCC1 |
| InChI | InChI=1S/C25H48N4O6/c1-23(2,3)33-20(30)27-15-11-16-29(22(32)35-25(7,8)9)19-18-28(14-10-12-26-13-17-27)21(31)34-24(4,5)6/h26H,10-19H2,1-9H3 |
| InChIKey | FIPOUUYFPSMVMX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|