C21H27NO13 — CID 10940053
ethyl (4R,5S,6S,7R)-4,5,6,7,8-pentaacetyloxy-2-cyano-3-oxooctanoate (PubChem CID 10940053) has the molecular formula C21H27NO13 and a molecular weight of 501.44 g/mol. Its IUPAC name is ethyl (4R,5S,6S,7R)-4,5,6,7,8-pentaacetyloxy-2-cyano-3-oxooctanoate.
| Compound Name | ethyl (4R,5S,6S,7R)-4,5,6,7,8-pentaacetyloxy-2-cyano-3-oxooctanoate |
|---|---|
| PubChem CID | 10940053 |
| Molecular Formula | C21H27NO13 |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | ethyl (4R,5S,6S,7R)-4,5,6,7,8-pentaacetyloxy-2-cyano-3-oxooctanoate |
| SMILES | CCOC(=O)C(C#N)C(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C21H27NO13/c1-7-30-21(29)15(8-22)17(28)19(34-13(5)26)20(35-14(6)27)18(33-12(4)25)16(32-11(3)24)9-31-10(2)23/h15-16,18-20H,7,9H2,1-6H3/t15?,16-,18+,19+,20+/m1/s1 |
| InChIKey | KJSQMMQRBSREJP-YUEQNIIUSA-N |
| XLogP | -0.45 |
| TPSA | 198.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|