C21H31IN6O — CID 109401140
N-[[6-(dimethylamino)-2-pyridinyl]methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109401140) has the molecular formula C21H31IN6O and a molecular weight of 510.42 g/mol. Its IUPAC name is N-[[6-(dimethylamino)-2-pyridinyl]methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[6-(dimethylamino)-2-pyridinyl]methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109401140 |
| Molecular Formula | C21H31IN6O |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | N-[[6-(dimethylamino)-2-pyridinyl]methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(N(C)C)n1)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C21H30N6O.HI/c1-22-21(23-16-17-8-7-11-20(24-17)25(2)3)27-14-12-26(13-15-27)18-9-5-6-10-19(18)28-4;/h5-11H,12-16H2,1-4H3,(H,22,23);1H |
| InChIKey | YXESOPBHLHKHGQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|