About 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one
3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one (PubChem CID 109402092) has the molecular formula C16H12FN3O5
and a molecular weight of 345.29 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one |
| PubChem CID | 109402092 |
| Molecular Formula | C16H12FN3O5 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one |
| SMILES | O=c1oc(-c2ccc([N+](=O)[O-])cc2)nn1CC(O)c1ccccc1F |
| InChI | InChI=1S/C16H12FN3O5/c17-13-4-2-1-3-12(13)14(21)9-19-16(22)25-15(18-19)10-5-7-11(8-6-10)20(23)24/h1-8,14,21H,9H2 |
| InChIKey | RSEHCWGAOGCUJK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one?
The IUPAC name of 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one (CID 109402092) is 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one?
The canonical SMILES for 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one is O=c1oc(-c2ccc([N+](=O)[O-])cc2)nn1CC(O)c1ccccc1F.
What is the InChIKey of 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one?
The InChIKey is RSEHCWGAOGCUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3O5/c17-13-4-2-1-3-12(13)14(21)9-19-16(22)25-15(18-19)10-5-7-11(8-6-10)20(23)24/h1-8,14,21H,9H2.
What are the key properties of 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one?
3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one has a molecular weight of 345.29 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-fluorophenyl)-2-hydroxyethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 109402092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).