C20H28N4 — CID 109402589
1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-phenylpropyl)guanidine (PubChem CID 109402589) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-phenylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109402589 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccccc1)NCCc1ccncc1C |
| InChI | InChI=1S/C20H28N4/c1-4-22-20(23-13-11-19-10-12-21-14-16(19)2)24-15-17(3)18-8-6-5-7-9-18/h5-10,12,14,17H,4,11,13,15H2,1-3H3,(H2,22,23,24) |
| InChIKey | OCHOZHXLSLKXNW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|