C27H43N2O5PSi — CID 10940455
(3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-2-[[(2S,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2λ5-oxazaphospholidin-2-yl]oxy]cyclohex-2-en-1-yl]azetidin-2-one (PubChem CID 10940455) has the molecular formula C27H43N2O5PSi and a molecular weight of 534.71 g/mol. Its IUPAC name is (3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-2-[[(2S,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2λ5-oxazaphospholidin-2-yl]oxy]cyclohex-2-en-1-yl]azetidin-2-one.
| Compound Name | (3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-2-[[(2S,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2λ5-oxazaphospholidin-2-yl]oxy]cyclohex-2-en-1-yl]azetidin-2-one |
|---|---|
| PubChem CID | 10940455 |
| Molecular Formula | C27H43N2O5PSi |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | (3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-2-[[(2S,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2λ5-oxazaphospholidin-2-yl]oxy]cyclohex-2-en-1-yl]azetidin-2-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N[C@H]1[C@@H]1CCCC=C1O[P@@]1(=O)O[C@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C27H43N2O5PSi/c1-18-25(20-14-10-9-11-15-20)33-35(31,29(18)6)32-22-17-13-12-16-21(22)24-23(26(30)28-24)19(2)34-36(7,8)27(3,4)5/h9-11,14-15,17-19,21,23-25H,12-13,16H2,1-8H3,(H,28,30)/t18-,19-,21+,23-,24-,25-,35+/m0/s1 |
| InChIKey | BVWZLXZWFMOEMH-MUTWPTQOSA-N |
| XLogP | 6.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|