C28H50O8Si — CID 10940527
3-[(1S,3R,6S,7R,9S,12R,14S,15S,19R)-6-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-17-methoxy-6,12-dimethyl-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icosan-7-yl]propanal (PubChem CID 10940527) has the molecular formula C28H50O8Si and a molecular weight of 542.79 g/mol. Its IUPAC name is 3-[(1S,3R,6S,7R,9S,12R,14S,15S,19R)-6-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-17-methoxy-6,12-dimethyl-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icosan-7-yl]propanal.
| Compound Name | 3-[(1S,3R,6S,7R,9S,12R,14S,15S,19R)-6-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-17-methoxy-6,12-dimethyl-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icosan-7-yl]propanal |
|---|---|
| PubChem CID | 10940527 |
| Molecular Formula | C28H50O8Si |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 3-[(1S,3R,6S,7R,9S,12R,14S,15S,19R)-6-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-17-methoxy-6,12-dimethyl-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icosan-7-yl]propanal |
| SMILES | COC1C[C@H](O)[C@@H]2O[C@]3(C)CC[C@@H]4O[C@H](CCC=O)[C@@](C)(O[Si](C)(C)C(C)(C)C)CC[C@H]4O[C@H]3C[C@H]2O1 |
| InChI | InChI=1S/C28H50O8Si/c1-26(2,3)37(7,8)36-28(5)14-12-20-19(32-22(28)10-9-15-29)11-13-27(4)23(33-20)17-21-25(35-27)18(30)16-24(31-6)34-21/h15,18-25,30H,9-14,16-17H2,1-8H3/t18-,19-,20+,21+,22+,23-,24?,25-,27+,28-/m0/s1 |
| InChIKey | JHRIDUVZDFTVDB-REWGHWPJSA-N |
| XLogP | 4.51 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|