C24H6F10O4 — CID 10940575
bis(2,3,4,5,6-pentafluorophenyl) naphthalene-2,6-dicarboxylate (PubChem CID 10940575) has the molecular formula C24H6F10O4 and a molecular weight of 548.29 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl) naphthalene-2,6-dicarboxylate.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl) naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10940575 |
| Molecular Formula | C24H6F10O4 |
| Molecular Weight | 548.29 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) naphthalene-2,6-dicarboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2cc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc2c1 |
| InChI | InChI=1S/C24H6F10O4/c25-11-13(27)17(31)21(18(32)14(11)28)37-23(35)9-3-1-7-5-10(4-2-8(7)6-9)24(36)38-22-19(33)15(29)12(26)16(30)20(22)34/h1-6H |
| InChIKey | TYFGIKOLARGKSW-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.29 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|