C40H56O — CID 10940627
3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-3,7,11,16,20,24,28-heptamethylnonacosa-3,5,7,9,11,13,15,17,19,21,23,27-dodecaenyl]-2,2-dimethyloxirane (PubChem CID 10940627) has the molecular formula C40H56O and a molecular weight of 552.89 g/mol. Its IUPAC name is 3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-3,7,11,16,20,24,28-heptamethylnonacosa-3,5,7,9,11,13,15,17,19,21,23,27-dodecaenyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-3,7,11,16,20,24,28-heptamethylnonacosa-3,5,7,9,11,13,15,17,19,21,23,27-dodecaenyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 10940627 |
| Molecular Formula | C40H56O |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.43 |
| IUPAC Name | 3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-3,7,11,16,20,24,28-heptamethylnonacosa-3,5,7,9,11,13,15,17,19,21,23,27-dodecaenyl]-2,2-dimethyloxirane |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C40H56O/c1-32(2)18-13-21-35(5)24-16-27-36(6)25-14-22-33(3)19-11-12-20-34(4)23-15-26-37(7)28-17-29-38(8)30-31-39-40(9,10)41-39/h11-12,14-20,22-29,39H,13,21,30-31H2,1-10H3/b12-11+,22-14+,23-15+,27-16+,28-17+,33-19+,34-20+,35-24+,36-25+,37-26+,38-29+ |
| InChIKey | GTXHICADEVOUIY-KSHBURSTSA-N |
| XLogP | 12.15 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|