C28H28F3N5O4 — CID 10940660
1-[(3-carbamimidoylphenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate (PubChem CID 10940660) has the molecular formula C28H28F3N5O4 and a molecular weight of 555.56 g/mol. Its IUPAC name is 1-[(3-carbamimidoylphenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | 1-[(3-carbamimidoylphenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10940660 |
| Molecular Formula | C28H28F3N5O4 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 1-[(3-carbamimidoylphenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCCc3cc[n+](C)cc3)cc3c(OC)cccc32)c1 |
| InChI | InChI=1S/C26H27N5O2.C2HF3O2/c1-30-13-10-18(11-14-30)9-12-29-26(32)23-16-21-22(7-4-8-24(21)33-2)31(23)17-19-5-3-6-20(15-19)25(27)28;3-2(4,5)1(6)7/h3-8,10-11,13-16H,9,12,17H2,1-2H3,(H3-,27,28,29,32);(H,6,7) |
| InChIKey | PIELOTJXCCAMPT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|