C20H27FIN3O2 — CID 109406843
1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-[(2-methoxyphenyl)methoxy]ethyl]guanidine;hydroiodide (PubChem CID 109406843) has the molecular formula C20H27FIN3O2 and a molecular weight of 487.36 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-[(2-methoxyphenyl)methoxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-[(2-methoxyphenyl)methoxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109406843 |
| Molecular Formula | C20H27FIN3O2 |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-[(2-methoxyphenyl)methoxy]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCCOCc1ccccc1OC.I |
| InChI | InChI=1S/C20H26FN3O2.HI/c1-3-22-20(24-14-16-7-6-9-18(21)13-16)23-11-12-26-15-17-8-4-5-10-19(17)25-2;/h4-10,13H,3,11-12,14-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | LESPDAWBMPXNOA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|