C22H20F6O6S2 — CID 10940685
[1-[2-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 10940685) has the molecular formula C22H20F6O6S2 and a molecular weight of 558.52 g/mol. Its IUPAC name is [1-[2-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-[2-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10940685 |
| Molecular Formula | C22H20F6O6S2 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | [1-[2-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1-c1c(OS(=O)(=O)C(F)(F)F)ccc3c1CCCC3)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C22H20F6O6S2/c23-21(24,25)35(29,30)33-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)34-36(31,32)22(26,27)28/h9-12H,1-8H2 |
| InChIKey | OVZQCLUCXHVUAD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|