C35H32N2O5 — CID 10940703
2-(2-methylprop-2-enoyloxy)ethyl 4-[(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)methyl]benzoate (PubChem CID 10940703) has the molecular formula C35H32N2O5 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-[(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)methyl]benzoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-[(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)methyl]benzoate |
|---|---|
| PubChem CID | 10940703 |
| Molecular Formula | C35H32N2O5 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-[(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)methyl]benzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc(CN2c3ccccc3C(C)(C)C23C=Nc2c(ccc4ccccc24)O3)cc1 |
| InChI | InChI=1S/C35H32N2O5/c1-23(2)32(38)40-19-20-41-33(39)26-15-13-24(14-16-26)21-37-29-12-8-7-11-28(29)34(3,4)35(37)22-36-31-27-10-6-5-9-25(27)17-18-30(31)42-35/h5-18,22H,1,19-21H2,2-4H3 |
| InChIKey | LVLYSSCVXXQYEI-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|