C20H30IN5 — CID 109407085
1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 109407085) has the molecular formula C20H30IN5 and a molecular weight of 467.40 g/mol. Its IUPAC name is 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109407085 |
| Molecular Formula | C20H30IN5 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1C)NCc1cccc(N(C)C)n1.I |
| InChI | InChI=1S/C20H29N5.HI/c1-6-21-20(22-13-17-11-10-15(2)12-16(17)3)23-14-18-8-7-9-19(24-18)25(4)5;/h7-12H,6,13-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | YNASUNTWNPZISE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|