About [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide
[1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide (PubChem CID 10940710) has the molecular formula C26H29INO3P
and a molecular weight of 561.40 g/mol. Its IUPAC name is [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide.
Molecular Properties
| Compound Name | [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide |
| PubChem CID | 10940710 |
| Molecular Formula | C26H29INO3P |
| Molecular Weight | 561.40 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide |
| SMILES | COC(=O)C(NC(=O)C(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C26H28NO3P.HI/c1-26(2,3)25(29)27-23(24(28)30-4)31(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22;/h5-19,23H,1-4H3;1H |
| InChIKey | ZPWURTVBFLLYOZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 561.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide?
The IUPAC name of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide (CID 10940710) is [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide.
What is the SMILES notation for [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide?
The canonical SMILES for [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide is COC(=O)C(NC(=O)C(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-].
What is the InChIKey of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide?
The InChIKey is ZPWURTVBFLLYOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28NO3P.HI/c1-26(2,3)25(29)27-23(24(28)30-4)31(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22;/h5-19,23H,1-4H3;1H.
What are the key properties of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide?
[1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide has a molecular weight of 561.40 g/mol, XLogP of 0.65, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium iodide is sourced from PubChem (CID 10940710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).