C18H29IN6O2 — CID 109407464
3-ethyl-2-[2-[(2-methoxyphenyl)methoxy]ethyl]-1-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109407464) has the molecular formula C18H29IN6O2 and a molecular weight of 488.37 g/mol. Its IUPAC name is 3-ethyl-2-[2-[(2-methoxyphenyl)methoxy]ethyl]-1-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[2-[(2-methoxyphenyl)methoxy]ethyl]-1-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109407464 |
| Molecular Formula | C18H29IN6O2 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 3-ethyl-2-[2-[(2-methoxyphenyl)methoxy]ethyl]-1-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOCc1ccccc1OC)N(C)Cc1ncnn1C.I |
| InChI | InChI=1S/C18H28N6O2.HI/c1-5-19-18(23(2)12-17-21-14-22-24(17)3)20-10-11-26-13-15-8-6-7-9-16(15)25-4;/h6-9,14H,5,10-13H2,1-4H3,(H,19,20);1H |
| InChIKey | ZWKQRZIVSRUDEP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|