C15H11N3O2S — CID 1094076
2-(4-acetylanilino)pyrido[3,2-e][1,3]thiazin-4-one (PubChem CID 1094076) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-(4-acetylanilino)pyrido[3,2-e][1,3]thiazin-4-one.
| Compound Name | 2-(4-acetylanilino)pyrido[3,2-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 1094076 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-(4-acetylanilino)pyrido[3,2-e][1,3]thiazin-4-one |
| SMILES | CC(=O)c1ccc(Nc2nc(=O)c3cccnc3s2)cc1 |
| InChI | InChI=1S/C15H11N3O2S/c1-9(19)10-4-6-11(7-5-10)17-15-18-13(20)12-3-2-8-16-14(12)21-15/h2-8H,1H3,(H,17,18,20) |
| InChIKey | XQQOOTQGWLYPAW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |