C15H25N3O3S — CID 109407705
1-(2-ethylsulfonylethyl)-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine (PubChem CID 109407705) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-(2-ethylsulfonylethyl)-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine.
| Compound Name | 1-(2-ethylsulfonylethyl)-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109407705 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(2-ethylsulfonylethyl)-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C15H25N3O3S/c1-3-22(20,21)10-9-17-15(16-2)18-11-14(12-19)13-7-5-4-6-8-13/h4-8,14,19H,3,9-12H2,1-2H3,(H2,16,17,18) |
| InChIKey | OIVAWQCYOMXKNW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|