C20H25IN6O — CID 109408808
1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109408808) has the molecular formula C20H25IN6O and a molecular weight of 492.37 g/mol. Its IUPAC name is 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109408808 |
| Molecular Formula | C20H25IN6O |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2cncn2)cc1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C20H24N6O.HI/c1-21-20(24-12-18(13-27)17-5-3-2-4-6-17)23-11-16-7-9-19(10-8-16)26-15-22-14-25-26;/h2-10,14-15,18,27H,11-13H2,1H3,(H2,21,23,24);1H |
| InChIKey | UZUVALHCYUDCJJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|