C19H30N4O2 — CID 109408961
1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine (PubChem CID 109408961) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 109408961 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCCC1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C19H30N4O2/c1-2-20-19(22-14-18(25)23-11-7-4-8-12-23)21-13-17(15-24)16-9-5-3-6-10-16/h3,5-6,9-10,17,24H,2,4,7-8,11-15H2,1H3,(H2,20,21,22) |
| InChIKey | RMPDCWFTONPYHF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|