About 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide
7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide (PubChem CID 10940897) has the molecular formula C29H33IN2O3
and a molecular weight of 584.50 g/mol. Its IUPAC name is 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide.
Molecular Properties
| Compound Name | 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide |
| PubChem CID | 10940897 |
| Molecular Formula | C29H33IN2O3 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide |
| SMILES | C[n+]1cccc(C(=O)OCCCCCCCn2ccc3cc(OCc4ccccc4)ccc32)c1.[I-] |
| InChI | InChI=1S/C29H33N2O3.HI/c1-30-17-10-13-26(22-30)29(32)33-20-9-4-2-3-8-18-31-19-16-25-21-27(14-15-28(25)31)34-23-24-11-6-5-7-12-24;/h5-7,10-17,19,21-22H,2-4,8-9,18,20,23H2,1H3;1H/q+1;/p-1 |
| InChIKey | BUYABKFQDGJWKB-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide?
The IUPAC name of 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide (CID 10940897) is 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide.
What is the SMILES notation for 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide?
The canonical SMILES for 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide is C[n+]1cccc(C(=O)OCCCCCCCn2ccc3cc(OCc4ccccc4)ccc32)c1.[I-].
What is the InChIKey of 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide?
The InChIKey is BUYABKFQDGJWKB-UHFFFAOYSA-M. The full InChI is InChI=1S/C29H33N2O3.HI/c1-30-17-10-13-26(22-30)29(32)33-20-9-4-2-3-8-18-31-19-16-25-21-27(14-15-28(25)31)34-23-24-11-6-5-7-12-24;/h5-7,10-17,19,21-22H,2-4,8-9,18,20,23H2,1H3;1H/q+1;/p-1.
What are the key properties of 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide?
7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide has a molecular weight of 584.50 g/mol, XLogP of 2.86, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-phenylmethoxyindol-1-yl)heptyl 1-methylpyridin-1-ium-3-carboxylate iodide is sourced from PubChem (CID 10940897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).