C30H32N2O8 — CID 10940912
methyl 2-(4-aminophenyl)-6,7-diethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate (PubChem CID 10940912) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-6,7-diethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-6,7-diethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10940912 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | methyl 2-(4-aminophenyl)-6,7-diethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
| SMILES | CCOc1cc2c(-c3cc(OC)c(OC)c(OC)c3)c(C(=O)OC)n(-c3ccc(N)cc3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C30H32N2O8/c1-7-39-22-15-20-21(16-23(22)40-8-2)29(33)32(19-11-9-18(31)10-12-19)27(30(34)38-6)26(20)17-13-24(35-3)28(37-5)25(14-17)36-4/h9-16H,7-8,31H2,1-6H3 |
| InChIKey | YLQDGZGJWWZLJN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|