C21H27IN6O — CID 109409524
1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109409524) has the molecular formula C21H27IN6O and a molecular weight of 506.39 g/mol. Its IUPAC name is 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109409524 |
| Molecular Formula | C21H27IN6O |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C21H26N6O.HI/c1-2-23-21(25-13-19(14-28)18-6-4-3-5-7-18)24-12-17-8-10-20(11-9-17)27-16-22-15-26-27;/h3-11,15-16,19,28H,2,12-14H2,1H3,(H2,23,24,25);1H |
| InChIKey | DHIWBRWUWNRGJO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|