C21H25ClIN5O — CID 109409605
1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 109409605) has the molecular formula C21H25ClIN5O and a molecular weight of 525.82 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109409605 |
| Molecular Formula | C21H25ClIN5O |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cnn(-c2ccc(Cl)cc2)c1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C21H24ClN5O.HI/c1-23-21(25-13-18(15-28)17-5-3-2-4-6-17)24-11-16-12-26-27(14-16)20-9-7-19(22)8-10-20;/h2-10,12,14,18,28H,11,13,15H2,1H3,(H2,23,24,25);1H |
| InChIKey | AAYYSJSDFXVSBY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|