C22H33IN4O2 — CID 109410120
1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 109410120) has the molecular formula C22H33IN4O2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109410120 |
| Molecular Formula | C22H33IN4O2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(CO)c1ccccc1)NCC(c1ccco1)N1CCCCC1.I |
| InChI | InChI=1S/C22H32N4O2.HI/c1-23-22(24-15-19(17-27)18-9-4-2-5-10-18)25-16-20(21-11-8-14-28-21)26-12-6-3-7-13-26;/h2,4-5,8-11,14,19-20,27H,3,6-7,12-13,15-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | DINLFQVIZCEHGH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|