C18H32IN3O3 — CID 109410122
1-(3-hydroxy-2-phenylpropyl)-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine;hydroiodide (PubChem CID 109410122) has the molecular formula C18H32IN3O3 and a molecular weight of 465.38 g/mol. Its IUPAC name is 1-(3-hydroxy-2-phenylpropyl)-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-hydroxy-2-phenylpropyl)-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109410122 |
| Molecular Formula | C18H32IN3O3 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 1-(3-hydroxy-2-phenylpropyl)-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCOCCOC)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C18H31N3O3.HI/c1-19-18(20-10-6-7-11-24-13-12-23-2)21-14-17(15-22)16-8-4-3-5-9-16;/h3-5,8-9,17,22H,6-7,10-15H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | GKQXENGGURWFAM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|