C37H37N3O5 — CID 10941033
methyl (1S,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 10941033) has the molecular formula C37H37N3O5 and a molecular weight of 603.72 g/mol. Its IUPAC name is methyl (1S,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1S,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10941033 |
| Molecular Formula | C37H37N3O5 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | methyl (1S,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H](C=C(C)C)N1C(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H37N3O5/c1-22(2)19-32-34-28(27-15-8-9-16-30(27)38-34)20-33(36(42)44-3)40(32)35(41)31-17-10-18-39(31)37(43)45-21-29-25-13-6-4-11-23(25)24-12-5-7-14-26(24)29/h4-9,11-16,19,29,31-33,38H,10,17-18,20-21H2,1-3H3/t31-,32-,33-/m0/s1 |
| InChIKey | LQQONOLGHYVFKH-ZDCRTTOTSA-N |
| XLogP | 6.51 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|