C18H27IN4O — CID 109410964
1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[(1-methylpyrrol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109410964) has the molecular formula C18H27IN4O and a molecular weight of 442.35 g/mol. Its IUPAC name is 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[(1-methylpyrrol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[(1-methylpyrrol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109410964 |
| Molecular Formula | C18H27IN4O |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[(1-methylpyrrol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccn(C)c1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C18H26N4O.HI/c1-3-19-18(20-11-15-9-10-22(2)13-15)21-12-17(14-23)16-7-5-4-6-8-16;/h4-10,13,17,23H,3,11-12,14H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | PISNDNFAZODMPS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|