C34H49NO7S — CID 10941122
1-O-[(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-O-methyl (2E)-2-[(4-methoxyphenyl)methylidene]propanedioate (PubChem CID 10941122) has the molecular formula C34H49NO7S and a molecular weight of 615.83 g/mol. Its IUPAC name is 1-O-[(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-O-methyl (2E)-2-[(4-methoxyphenyl)methylidene]propanedioate.
| Compound Name | 1-O-[(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-O-methyl (2E)-2-[(4-methoxyphenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 10941122 |
| Molecular Formula | C34H49NO7S |
| Molecular Weight | 615.83 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | 1-O-[(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-O-methyl (2E)-2-[(4-methoxyphenyl)methylidene]propanedioate |
| SMILES | COC(=O)/C(=C\c1ccc(OC)cc1)C(=O)O[C@H]1C[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C |
| InChI | InChI=1S/C34H49NO7S/c1-33(2)25-19-20-34(33,23-43(38,39)35(26-11-7-5-8-12-26)27-13-9-6-10-14-27)30(22-25)42-32(37)29(31(36)41-4)21-24-15-17-28(40-3)18-16-24/h15-18,21,25-27,30H,5-14,19-20,22-23H2,1-4H3/b29-21+/t25-,30-,34-/m0/s1 |
| InChIKey | PLAITRWQYWCTMB-VEWJHICBSA-N |
| XLogP | 6.29 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.83 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|