About 5-ethenylidenenonane
5-ethenylidenenonane (PubChem CID 10941127) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is 5-ethenylidenenonane.
Molecular Properties
| Compound Name | 5-ethenylidenenonane |
| PubChem CID | 10941127 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 5-ethenylidenenonane |
| SMILES | C=C=C(CCCC)CCCC |
| InChI | InChI=1S/C11H20/c1-4-7-9-11(6-3)10-8-5-2/h3-5,7-10H2,1-2H3 |
| InChIKey | FVMGSERLTGVZAD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-ethenylidenenonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylidenenonane?
The IUPAC name of 5-ethenylidenenonane (CID 10941127) is 5-ethenylidenenonane.
What is the SMILES notation for 5-ethenylidenenonane?
The canonical SMILES for 5-ethenylidenenonane is C=C=C(CCCC)CCCC.
What is the InChIKey of 5-ethenylidenenonane?
The InChIKey is FVMGSERLTGVZAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-4-7-9-11(6-3)10-8-5-2/h3-5,7-10H2,1-2H3.
What are the key properties of 5-ethenylidenenonane?
5-ethenylidenenonane has a molecular weight of 152.28 g/mol, XLogP of 4.08, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylidenenonane is sourced from PubChem (CID 10941127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).