C18H16F3N3O — CID 109411339
1-(2-pyridin-2-ylimidazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 109411339) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylimidazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-(2-pyridin-2-ylimidazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 109411339 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-(2-pyridin-2-ylimidazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | OC(Cc1ccc(C(F)(F)F)cc1)Cn1ccnc1-c1ccccn1 |
| InChI | InChI=1S/C18H16F3N3O/c19-18(20,21)14-6-4-13(5-7-14)11-15(25)12-24-10-9-23-17(24)16-3-1-2-8-22-16/h1-10,15,25H,11-12H2 |
| InChIKey | NEUCEVUSCMXKQF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |