C17H24N2O3 — CID 109411477
1-[2-(1-ethoxyethyl)imidazol-1-yl]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 109411477) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[2-(1-ethoxyethyl)imidazol-1-yl]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(1-ethoxyethyl)imidazol-1-yl]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 109411477 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[2-(1-ethoxyethyl)imidazol-1-yl]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | CCOC(C)c1nccn1CC(O)COc1ccccc1C |
| InChI | InChI=1S/C17H24N2O3/c1-4-21-14(3)17-18-9-10-19(17)11-15(20)12-22-16-8-6-5-7-13(16)2/h5-10,14-15,20H,4,11-12H2,1-3H3 |
| InChIKey | NPYDMXZHFQOUJE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |