C34H54O7Si2 — CID 10941217
(2S,3R,4R,4aS,6R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(2-hydroxyethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol (PubChem CID 10941217) has the molecular formula C34H54O7Si2 and a molecular weight of 630.97 g/mol. Its IUPAC name is (2S,3R,4R,4aS,6R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(2-hydroxyethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol.
| Compound Name | (2S,3R,4R,4aS,6R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(2-hydroxyethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol |
|---|---|
| PubChem CID | 10941217 |
| Molecular Formula | C34H54O7Si2 |
| Molecular Weight | 630.97 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | (2S,3R,4R,4aS,6R,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(2-hydroxyethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H]2O[C@@H](CCO)[C@H](O)[C@@H](O)[C@@H]2O[C@@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H54O7Si2/c1-33(2,3)42(7,8)41-28-23-29-32(31(37)30(36)27(39-29)19-21-35)40-26(28)20-22-38-43(34(4,5)6,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,26-32,35-37H,19-23H2,1-8H3/t26-,27+,28+,29-,30+,31-,32-/m1/s1 |
| InChIKey | PQNZDOXRVXERKU-NGOJXASSSA-N |
| XLogP | 4.37 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.97 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|