C37H50O9S — CID 10941408
(2R,5R)-4-(benzenesulfonyl)-1-[(4-methoxyphenyl)methoxy]-5-[(4S,5S)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylhexan-3-ol (PubChem CID 10941408) has the molecular formula C37H50O9S and a molecular weight of 670.87 g/mol. Its IUPAC name is (2R,5R)-4-(benzenesulfonyl)-1-[(4-methoxyphenyl)methoxy]-5-[(4S,5S)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylhexan-3-ol.
| Compound Name | (2R,5R)-4-(benzenesulfonyl)-1-[(4-methoxyphenyl)methoxy]-5-[(4S,5S)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylhexan-3-ol |
|---|---|
| PubChem CID | 10941408 |
| Molecular Formula | C37H50O9S |
| Molecular Weight | 670.87 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | (2R,5R)-4-(benzenesulfonyl)-1-[(4-methoxyphenyl)methoxy]-5-[(4S,5S)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylhexan-3-ol |
| SMILES | COc1ccc(COC[C@@H](C)C(O)C([C@H](C)[C@@H]2OC(C)(C)O[C@H]2[C@@H](C)COCc2ccc(OC)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H50O9S/c1-25(21-43-23-28-13-17-30(41-6)18-14-28)33(38)36(47(39,40)32-11-9-8-10-12-32)27(3)35-34(45-37(4,5)46-35)26(2)22-44-24-29-15-19-31(42-7)20-16-29/h8-20,25-27,33-36,38H,21-24H2,1-7H3/t25-,26+,27-,33?,34+,35+,36?/m1/s1 |
| InChIKey | FPQBRTYWPGLIEV-FCHLRGJRSA-N |
| XLogP | 6.07 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.87 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |