C19H21N3O3 — CID 109415206
4-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropoxy]benzamide (PubChem CID 109415206) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropoxy]benzamide.
| Compound Name | 4-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropoxy]benzamide |
|---|---|
| PubChem CID | 109415206 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropoxy]benzamide |
| SMILES | Cc1cc2ncn(CC(O)COc3ccc(C(N)=O)cc3)c2cc1C |
| InChI | InChI=1S/C19H21N3O3/c1-12-7-17-18(8-13(12)2)22(11-21-17)9-15(23)10-25-16-5-3-14(4-6-16)19(20)24/h3-8,11,15,23H,9-10H2,1-2H3,(H2,20,24) |
| InChIKey | WBBCAXGRAQIIKE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |