About CID 10941657
CID 10941657 (PubChem CID 10941657) has the molecular formula C40H46Cl2FeN2O4
and a molecular weight of 745.57 g/mol.
Molecular Properties
| Compound Name | CID 10941657 |
| PubChem CID | 10941657 |
| Molecular Formula | C40H46Cl2FeN2O4 |
| Molecular Weight | 745.57 g/mol |
| Exact Mass | 744.22 |
| IUPAC Name | — |
| SMILES | O=C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)[C]1[CH][CH][CH][CH]1.O=C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)[C]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/2C20H23ClNO2.Fe/c2*21-18-9-7-17(8-10-18)20(24)11-14-22(15-12-20)13-3-6-19(23)16-4-1-2-5-16;/h2*1-2,4-5,7-10,24H,3,6,11-15H2; |
| InChIKey | KETOBCGDJIVKNJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 745.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10941657 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10941657?
The IUPAC name of CID 10941657 (CID 10941657) is not available.
What is the SMILES notation for CID 10941657?
The canonical SMILES for CID 10941657 is O=C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)[C]1[CH][CH][CH][CH]1.O=C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)[C]1[CH][CH][CH][CH]1.[Fe].
What is the InChIKey of CID 10941657?
The InChIKey is KETOBCGDJIVKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H23ClNO2.Fe/c2*21-18-9-7-17(8-10-18)20(24)11-14-22(15-12-20)13-3-6-19(23)16-4-1-2-5-16;/h2*1-2,4-5,7-10,24H,3,6,11-15H2;.
What are the key properties of CID 10941657?
CID 10941657 has a molecular weight of 745.57 g/mol, XLogP of 6.75, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10941657 is sourced from PubChem (CID 10941657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).