C53H45N5O4 — CID 10941931
dimethyl (2S,3R,4R)-1-methyl-2-[(4Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,6,21,23-tetrahydroporphyrin-2-yl]pyrrolidine-3,4-dicarboxylate (PubChem CID 10941931) has the molecular formula C53H45N5O4 and a molecular weight of 815.97 g/mol. Its IUPAC name is dimethyl (2S,3R,4R)-1-methyl-2-[(4Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,6,21,23-tetrahydroporphyrin-2-yl]pyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl (2S,3R,4R)-1-methyl-2-[(4Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,6,21,23-tetrahydroporphyrin-2-yl]pyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10941931 |
| Molecular Formula | C53H45N5O4 |
| Molecular Weight | 815.97 g/mol |
| Exact Mass | 815.35 |
| IUPAC Name | dimethyl (2S,3R,4R)-1-methyl-2-[(4Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,6,21,23-tetrahydroporphyrin-2-yl]pyrrolidine-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)CN(C)[C@@H]1C1=C/C2=C(\c3ccccc3)C3C=CC(=N3)/C(c3ccccc3)=c3/cc/c([nH]3)=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C1N2)C=C3 |
| InChI | InChI=1S/C53H45N5O4/c1-58-31-37(52(59)61-2)49(53(60)62-3)51(58)36-30-44-47(34-20-12-6-13-21-34)42-27-26-40(55-42)45(32-16-8-4-9-17-32)38-24-25-39(54-38)46(33-18-10-5-11-19-33)41-28-29-43(56-41)48(50(36)57-44)35-22-14-7-15-23-35/h4-30,37,42,49-51,54,57H,31H2,1-3H3/b45-38-,46-39-,47-44-,48-43-/t37-,42?,49+,50?,51+/m0/s1 |
| InChIKey | VNBRFQCYXLBBET-GISDHNGYSA-N |
| XLogP | 6.43 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |