C48H70N4O13 — CID 10941982
(2S)-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (PubChem CID 10941982) has the molecular formula C48H70N4O13 and a molecular weight of 911.10 g/mol. Its IUPAC name is (2S)-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 10941982 |
| Molecular Formula | C48H70N4O13 |
| Molecular Weight | 911.10 g/mol |
| Exact Mass | 910.49 |
| IUPAC Name | (2S)-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)(C)OC(=O)CN(CC(=O)OC(C)(C)C)CC(C(=O)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C48H70N4O13/c1-45(2,3)62-38(53)26-51(27-39(54)63-46(4,5)6)25-37(52(28-40(55)64-47(7,8)9)29-41(56)65-48(10,11)12)42(57)49-24-18-17-23-36(43(58)59)50-44(60)61-30-35-33-21-15-13-19-31(33)32-20-14-16-22-34(32)35/h13-16,19-22,35-37H,17-18,23-30H2,1-12H3,(H,49,57)(H,50,60)(H,58,59)/t36-,37?/m0/s1 |
| InChIKey | OXWOWXXSUDBIFH-NWDJCJOJSA-N |
| XLogP | 5.60 |
| TPSA | 216.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.10 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|