C22H32IN5O2S — CID 109420449
1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 109420449) has the molecular formula C22H32IN5O2S and a molecular weight of 557.50 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420449 |
| Molecular Formula | C22H32IN5O2S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCN(c2ccccc2)CC1)NCC(C)(O)c1cccs1.I |
| InChI | InChI=1S/C22H31N5O2S.HI/c1-3-23-21(25-17-22(2,29)19-10-7-15-30-19)24-16-20(28)27-13-11-26(12-14-27)18-8-5-4-6-9-18;/h4-10,15,29H,3,11-14,16-17H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | NBKJOHYJDZNLOO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|