C20H30N6OS — CID 109422046
3-ethyl-1-methyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109422046) has the molecular formula C20H30N6OS and a molecular weight of 402.57 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109422046 |
| Molecular Formula | C20H30N6OS |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-ethyl-1-methyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOC(C)C2)nc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C20H30N6OS/c1-5-21-20(25(4)13-18-14-28-16(3)24-18)23-11-17-6-7-19(22-10-17)26-8-9-27-15(2)12-26/h6-7,10,14-15H,5,8-9,11-13H2,1-4H3,(H,21,23) |
| InChIKey | RWFFETCQGXOMAE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|