C21H31N5OS — CID 109422250
3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109422250) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109422250 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC(c1cccc(OC)c1)N1CCCC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C21H31N5OS/c1-16-24-18(15-28-16)14-25(3)21(22-2)23-13-20(26-10-5-6-11-26)17-8-7-9-19(12-17)27-4/h7-9,12,15,20H,5-6,10-11,13-14H2,1-4H3,(H,22,23) |
| InChIKey | LLAMQRXTSSXYOH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|