C14H23F3N4OS — CID 109422642
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 109422642) has the molecular formula C14H23F3N4OS and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 109422642 |
| Molecular Formula | C14H23F3N4OS |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C14H23F3N4OS/c1-4-18-13(19-6-5-7-22-10-14(15,16)17)21(3)8-12-9-23-11(2)20-12/h9H,4-8,10H2,1-3H3,(H,18,19) |
| InChIKey | YPJCNRSMWICYSD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|