C20H31IN4O2S2 — CID 109423305
3-[1-(3,4-dimethylphenyl)sulfonylbutan-2-yl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423305) has the molecular formula C20H31IN4O2S2 and a molecular weight of 550.53 g/mol. Its IUPAC name is 3-[1-(3,4-dimethylphenyl)sulfonylbutan-2-yl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[1-(3,4-dimethylphenyl)sulfonylbutan-2-yl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423305 |
| Molecular Formula | C20H31IN4O2S2 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 3-[1-(3,4-dimethylphenyl)sulfonylbutan-2-yl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(CS(=O)(=O)c1ccc(C)c(C)c1)N/C(=N/C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C20H30N4O2S2.HI/c1-7-17(13-28(25,26)19-9-8-14(2)15(3)10-19)23-20(21-5)24(6)11-18-12-27-16(4)22-18;/h8-10,12,17H,7,11,13H2,1-6H3,(H,21,23);1H |
| InChIKey | MMUZBDCJRQEAGD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|