About (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene
(1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 10942345) has the molecular formula C6H6O
and a molecular weight of 94.11 g/mol. Its IUPAC name is (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 10942345 |
| Molecular Formula | C6H6O |
| Molecular Weight | 94.11 g/mol |
| Exact Mass | 94.04 |
| IUPAC Name | (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | C1=C[C@@H]2O[C@@H]2C=C1 |
| InChI | InChI=1S/C6H6O/c1-2-4-6-5(3-1)7-6/h1-6H/t5-,6+ |
| InChIKey | WDFZWSZNOFELJY-OLQVQODUSA-N |
| XLogP | 0.88 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.11 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene (CID 10942345) is (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene is C1=C[C@@H]2O[C@@H]2C=C1.
What is the InChIKey of (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is WDFZWSZNOFELJY-OLQVQODUSA-N. The full InChI is InChI=1S/C6H6O/c1-2-4-6-5(3-1)7-6/h1-6H/t5-,6+.
What are the key properties of (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
(1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 94.11 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-7-oxabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 10942345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).