C5H6O3 — CID 10942385
(1R,5S)-6,7,8-trioxabicyclo[3.2.1]oct-2-ene (PubChem CID 10942385) has the molecular formula C5H6O3 and a molecular weight of 114.10 g/mol. Its IUPAC name is (1R,5S)-6,7,8-trioxabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1R,5S)-6,7,8-trioxabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 10942385 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | (1R,5S)-6,7,8-trioxabicyclo[3.2.1]oct-2-ene |
| SMILES | C1=C[C@H]2OO[C@@H](C1)O2 |
| InChI | InChI=1S/C5H6O3/c1-2-4-6-5(3-1)8-7-4/h1-2,4-5H,3H2/t4-,5+/m1/s1 |
| InChIKey | HWALNXDUJPKJGP-UHNVWZDZSA-N |
| XLogP | 0.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|