C6H8O3 — CID 10942433
3,4-dihydroxycyclohex-2-en-1-one (PubChem CID 10942433) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 3,4-dihydroxycyclohex-2-en-1-one.
| Compound Name | 3,4-dihydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10942433 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 3,4-dihydroxycyclohex-2-en-1-one |
| SMILES | O=C1C=C(O)C(O)CC1 |
| InChI | InChI=1S/C6H8O3/c7-4-1-2-5(8)6(9)3-4/h3,5,8-9H,1-2H2 |
| InChIKey | MLFCBHMTPDUJMU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |