C22H33N5O2S — CID 109424380
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine (PubChem CID 109424380) has the molecular formula C22H33N5O2S and a molecular weight of 431.61 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109424380 |
| Molecular Formula | C22H33N5O2S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCCN2CCOCC2)c1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C22H33N5O2S/c1-4-23-22(26(3)16-20-17-30-18(2)25-20)24-15-19-6-5-7-21(14-19)29-13-10-27-8-11-28-12-9-27/h5-7,14,17H,4,8-13,15-16H2,1-3H3,(H,23,24) |
| InChIKey | XNQPEZUULGCXPT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|